![]() | |
Names | |
---|---|
Preferred IUPAC name
(13Z)-Docos-13-enoic acid | |
Other names
C22:1 (Lipid numbers)
| |
Identifiers | |
3D model (JSmol)
|
|
1728049 | |
ChEBI | |
ChEMBL | |
ChemSpider | |
ECHA InfoCard | 100.003.647 |
EC Number |
|
177365 | |
KEGG | |
PubChem CID
|
|
UNII | |
CompTox Dashboard (EPA)
|
|
| |
| |
Properties | |
C22H42O2 | |
Molar mass | 338.576 g·mol−1 |
Appearance | White waxy solid |
Density | 0.860 g/cm3 |
Melting point | 33.8 °C (92.8 °F; 306.9 K) |
Boiling point | 381.5 °C (718.7 °F; 654.6 K) (decomposes) |
Insoluble | |
Solubility in methanol and ethanol | Soluble |
Hazards | |
GHS labelling:[1] | |
![]() | |
Warning | |
H315, H319, H335 | |
P261, P264, P271, P280, P302+P352, P304+P340, P305+P351+P338, P312, P321, P332+P313, P337+P313, P362, P403+P233, P405, P501 | |
Flash point | 349.9 °C (661.8 °F; 623.0 K) |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Erucic acid is a monounsaturated omega-9 fatty acid, denoted 22:1ω9. It has the chemical formula: CH3(CH2)7CH=CH(CH2)11CO2H. It is prevalent in wallflower seed and other plants in the family Brassicaceae, with a reported content of 20 to 54% in high erucic acid rapeseed oil[2] and 42% in mustard oil. Erucic acid is also known as cis-13-docosenoic acid and the trans isomer is known as brassidic acid.
© MMXXIII Rich X Search. We shall prevail. All rights reserved. Rich X Search